C13H18O3 — CID 89249866
(2Z,4E)-5-[(1S)-2-methoxy-4-oxocyclohexyl]-3-methylpenta-2,4-dienal (PubChem CID 89249866) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2Z,4E)-5-[(1S)-2-methoxy-4-oxocyclohexyl]-3-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-5-[(1S)-2-methoxy-4-oxocyclohexyl]-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 89249866 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2Z,4E)-5-[(1S)-2-methoxy-4-oxocyclohexyl]-3-methylpenta-2,4-dienal |
| SMILES | COC1CC(=O)CC[C@H]1/C=C/C(C)=C\C=O |
| InChI | InChI=1S/C13H18O3/c1-10(7-8-14)3-4-11-5-6-12(15)9-13(11)16-2/h3-4,7-8,11,13H,5-6,9H2,1-2H3/b4-3+,10-7-/t11-,13?/m1/s1 |
| InChIKey | OIKIUHZZRVSBOC-ZQQWCIRYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|