C15H27N5 — CID 89250349
2-[(3Z)-2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)hepta-1,3-dien-4-yl]guanidine (PubChem CID 89250349) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 2-[(3Z)-2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)hepta-1,3-dien-4-yl]guanidine.
| Compound Name | 2-[(3Z)-2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)hepta-1,3-dien-4-yl]guanidine |
|---|---|
| PubChem CID | 89250349 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 2-[(3Z)-2-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)hepta-1,3-dien-4-yl]guanidine |
| SMILES | C=C(/C=C(/CCC)N=C(N)N)N1CC2CCC(C1)N2C |
| InChI | InChI=1S/C15H27N5/c1-4-5-12(18-15(16)17)8-11(2)20-9-13-6-7-14(10-20)19(13)3/h8,13-14H,2,4-7,9-10H2,1,3H3,(H4,16,17,18)/b12-8- |
| InChIKey | LWGYZYXHUSHENP-WQLSENKSSA-N |
| XLogP | 1.24 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|