C10H18IN3S — CID 89250595
2-N-iodo-6-N-propyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine (PubChem CID 89250595) has the molecular formula C10H18IN3S and a molecular weight of 339.25 g/mol. Its IUPAC name is 2-N-iodo-6-N-propyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-iodo-6-N-propyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 89250595 |
| Molecular Formula | C10H18IN3S |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-N-iodo-6-N-propyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCNC1CCC2=C(C1)SC(NI)N2 |
| InChI | InChI=1S/C10H18IN3S/c1-2-5-12-7-3-4-8-9(6-7)15-10(13-8)14-11/h7,10,12-14H,2-6H2,1H3 |
| InChIKey | QJYPPJDCLAOPMD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|