C25H23NO2S2 — CID 89250740
N-[3-[2-(7-methylsulfanyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethenyl]phenyl]methanesulfonamide (PubChem CID 89250740) has the molecular formula C25H23NO2S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[3-[2-(7-methylsulfanyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-(7-methylsulfanyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 89250740 |
| Molecular Formula | C25H23NO2S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[3-[2-(7-methylsulfanyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethenyl]phenyl]methanesulfonamide |
| SMILES | CSc1cccc2c1CCc1ccccc1C2=C=Cc1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H23NO2S2/c1-29-25-12-6-11-22-23(21-10-4-3-8-19(21)14-16-24(22)25)15-13-18-7-5-9-20(17-18)26-30(2,27)28/h3-13,17,26H,14,16H2,1-2H3 |
| InChIKey | ZWTCJYYOXRSLTR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |