C14H23ClO2 — CID 89250810
(1R,2R,6S,8R)-2-(2-chloroethyl)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decane (PubChem CID 89250810) has the molecular formula C14H23ClO2 and a molecular weight of 258.79 g/mol. Its IUPAC name is (1R,2R,6S,8R)-2-(2-chloroethyl)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decane.
| Compound Name | (1R,2R,6S,8R)-2-(2-chloroethyl)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 89250810 |
| Molecular Formula | C14H23ClO2 |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (1R,2R,6S,8R)-2-(2-chloroethyl)-4,4,9,9-tetramethyl-3,5-dioxatricyclo[6.1.1.02,6]decane |
| SMILES | CC1(C)O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(CCCl)O1 |
| InChI | InChI=1S/C14H23ClO2/c1-12(2)9-7-10(12)14(5-6-15)11(8-9)16-13(3,4)17-14/h9-11H,5-8H2,1-4H3/t9-,10-,11+,14-/m1/s1 |
| InChIKey | HYLIRCNDXVJCOV-NJBDSQKTSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|