About N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride
N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride (PubChem CID 89250882) has the molecular formula C8H12ClN
and a molecular weight of 157.64 g/mol. Its IUPAC name is N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride.
Molecular Properties
| Compound Name | N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride |
| PubChem CID | 89250882 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride |
| SMILES | C=C/C(=C\N=C(/C)Cl)CC |
| InChI | InChI=1S/C8H12ClN/c1-4-8(5-2)6-10-7(3)9/h4,6H,1,5H2,2-3H3/b8-6+,10-7+ |
| InChIKey | GVQFYCRBQRLLHR-NBANWCDVSA-N |
| XLogP | 3.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride?
The IUPAC name of N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride (CID 89250882) is N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride.
What is the SMILES notation for N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride?
The canonical SMILES for N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride is C=C/C(=C\N=C(/C)Cl)CC.
What is the InChIKey of N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride?
The InChIKey is GVQFYCRBQRLLHR-NBANWCDVSA-N. The full InChI is InChI=1S/C8H12ClN/c1-4-8(5-2)6-10-7(3)9/h4,6H,1,5H2,2-3H3/b8-6+,10-7+.
What are the key properties of N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride?
N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride has a molecular weight of 157.64 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2-ethylbuta-1,3-dienyl]ethanimidoyl chloride is sourced from PubChem (CID 89250882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).