C22H27N7O3S — CID 89250989
5-cyano-N-[6-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)-2-(4-methylidenecyclohexen-1-yl)-3-pyridinyl]-4,5-dihydro-1H-imidazole-2-carboxamide (PubChem CID 89250989) has the molecular formula C22H27N7O3S and a molecular weight of 469.57 g/mol. Its IUPAC name is 5-cyano-N-[6-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)-2-(4-methylidenecyclohexen-1-yl)-3-pyridinyl]-4,5-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | 5-cyano-N-[6-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)-2-(4-methylidenecyclohexen-1-yl)-3-pyridinyl]-4,5-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 89250989 |
| Molecular Formula | C22H27N7O3S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-cyano-N-[6-(2,6-dimethyl-1,1-dioxo-1,2,6-thiadiazinan-4-yl)-2-(4-methylidenecyclohexen-1-yl)-3-pyridinyl]-4,5-dihydro-1H-imidazole-2-carboxamide |
| SMILES | C=C1CC=C(c2nc(C3CN(C)S(=O)(=O)N(C)C3)ccc2NC(=O)C2=NCC(C#N)N2)CC1 |
| InChI | InChI=1S/C22H27N7O3S/c1-14-4-6-15(7-5-14)20-19(27-22(30)21-24-11-17(10-23)25-21)9-8-18(26-20)16-12-28(2)33(31,32)29(3)13-16/h6,8-9,16-17H,1,4-5,7,11-13H2,2-3H3,(H,24,25)(H,27,30) |
| InChIKey | RVJDKOBNIHVHGC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|