C25H22N8 — CID 89251085
1-N,3-N-bis(4-aminophenyl)-7-N-(1,3,5-triazin-2-yl)naphthalene-1,3,7-triamine (PubChem CID 89251085) has the molecular formula C25H22N8 and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-N,3-N-bis(4-aminophenyl)-7-N-(1,3,5-triazin-2-yl)naphthalene-1,3,7-triamine.
| Compound Name | 1-N,3-N-bis(4-aminophenyl)-7-N-(1,3,5-triazin-2-yl)naphthalene-1,3,7-triamine |
|---|---|
| PubChem CID | 89251085 |
| Molecular Formula | C25H22N8 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-N,3-N-bis(4-aminophenyl)-7-N-(1,3,5-triazin-2-yl)naphthalene-1,3,7-triamine |
| SMILES | Nc1ccc(Nc2cc(Nc3ccc(N)cc3)c3cc(Nc4ncncn4)ccc3c2)cc1 |
| InChI | InChI=1S/C25H22N8/c26-17-2-7-19(8-3-17)31-22-11-16-1-6-21(33-25-29-14-28-15-30-25)12-23(16)24(13-22)32-20-9-4-18(27)5-10-20/h1-15,31-32H,26-27H2,(H,28,29,30,33) |
| InChIKey | OICGKROKKPCJIW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|