C5BF8N2Na — CID 89251127
sodium dicyano-fluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide (PubChem CID 89251127) has the molecular formula C5BF8N2Na and a molecular weight of 273.86 g/mol. Its IUPAC name is sodium dicyano-fluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide.
| Compound Name | sodium dicyano-fluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
|---|---|
| PubChem CID | 89251127 |
| Molecular Formula | C5BF8N2Na |
| Molecular Weight | 273.86 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | sodium dicyano-fluoro-(1,1,2,2,3,3,3-heptafluoropropyl)boranuide |
| SMILES | N#C[B-](F)(C#N)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C5BF8N2.Na/c7-3(8,5(11,12)13)4(9,10)6(14,1-15)2-16;/q-1;+1 |
| InChIKey | MRPNIJWRMMSHJJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.86 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|