C19H33O4P — CID 89251134
diethyl 3,7,11-trimethyldodeca-1,4,6,10-tetraenyl phosphate (PubChem CID 89251134) has the molecular formula C19H33O4P and a molecular weight of 356.44 g/mol. Its IUPAC name is diethyl 3,7,11-trimethyldodeca-1,4,6,10-tetraenyl phosphate.
| Compound Name | diethyl 3,7,11-trimethyldodeca-1,4,6,10-tetraenyl phosphate |
|---|---|
| PubChem CID | 89251134 |
| Molecular Formula | C19H33O4P |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | diethyl 3,7,11-trimethyldodeca-1,4,6,10-tetraenyl phosphate |
| SMILES | CCOP(=O)(OC=CC(C)C=CC=C(C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C19H33O4P/c1-7-21-24(20,22-8-2)23-16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h10-11,13-16,19H,7-9,12H2,1-6H3 |
| InChIKey | LWEGWKVXLFFOBP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|