C11H13BF6N4O — CID 89251147
dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-(1-methoxyethyl)-3-methylimidazol-3-ium (PubChem CID 89251147) has the molecular formula C11H13BF6N4O and a molecular weight of 342.05 g/mol. Its IUPAC name is dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-(1-methoxyethyl)-3-methylimidazol-3-ium.
| Compound Name | dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-(1-methoxyethyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 89251147 |
| Molecular Formula | C11H13BF6N4O |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | dicyano-fluoro-(1,1,2,2,2-pentafluoroethyl)boranuide;1-(1-methoxyethyl)-3-methylimidazol-3-ium |
| SMILES | COC(C)n1cc[n+](C)c1.N#C[B-](F)(C#N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13N2O.C4BF6N2/c1-7(10-3)9-5-4-8(2)6-9;6-3(7,4(8,9)10)5(11,1-12)2-13/h4-7H,1-3H3;/q+1;-1 |
| InChIKey | XTMJSVRNKHQWDG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 65.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|