C5BF11NNa — CID 89251497
sodium cyano-difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide (PubChem CID 89251497) has the molecular formula C5BF11NNa and a molecular weight of 316.84 g/mol. Its IUPAC name is sodium cyano-difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide.
| Compound Name | sodium cyano-difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide |
|---|---|
| PubChem CID | 89251497 |
| Molecular Formula | C5BF11NNa |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | sodium cyano-difluoro-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)boranuide |
| SMILES | N#C[B-](F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C5BF11N.Na/c7-2(8,3(9,10)5(13,14)15)4(11,12)6(16,17)1-18;/q-1;+1 |
| InChIKey | MXJQUKBTVDOOCB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|