About 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine
7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine (PubChem CID 89251616) has the molecular formula C6H8F2N2
and a molecular weight of 146.14 g/mol. Its IUPAC name is 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine |
| PubChem CID | 89251616 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine |
| SMILES | FC(F)C1=CC=NCCN1 |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)5-1-2-9-3-4-10-5/h1-2,6,10H,3-4H2 |
| InChIKey | WMCMGGHPECODHS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The IUPAC name of 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine (CID 89251616) is 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine.
What is the SMILES notation for 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The canonical SMILES for 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine is FC(F)C1=CC=NCCN1.
What is the InChIKey of 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
The InChIKey is WMCMGGHPECODHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2/c7-6(8)5-1-2-9-3-4-10-5/h1-2,6,10H,3-4H2.
What are the key properties of 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine?
7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine has a molecular weight of 146.14 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethyl)-2,3-dihydro-1H-1,4-diazepine is sourced from PubChem (CID 89251616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).