About N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride
N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride (PubChem CID 89251665) has the molecular formula C6H12Cl2N2S
and a molecular weight of 215.15 g/mol. Its IUPAC name is N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride |
| PubChem CID | 89251665 |
| Molecular Formula | C6H12Cl2N2S |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride |
| SMILES | CNc1sc(C)nc1C.Cl.Cl |
| InChI | InChI=1S/C6H10N2S.2ClH/c1-4-6(7-3)9-5(2)8-4;;/h7H,1-3H3;2*1H |
| InChIKey | WYNQFOPRXCJCTK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride?
The IUPAC name of N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride (CID 89251665) is N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride.
What is the SMILES notation for N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride?
The canonical SMILES for N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride is CNc1sc(C)nc1C.Cl.Cl.
What is the InChIKey of N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride?
The InChIKey is WYNQFOPRXCJCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S.2ClH/c1-4-6(7-3)9-5(2)8-4;;/h7H,1-3H3;2*1H.
What are the key properties of N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride?
N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride has a molecular weight of 215.15 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,4-trimethyl-1,3-thiazol-5-amine;dihydrochloride is sourced from PubChem (CID 89251665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).