C16H13Cl3N2O4S — CID 89251693
4-(2-oxo-1,3-diazinan-1-yl)-2-(2,4,5-trichlorophenyl)benzenesulfonic acid (PubChem CID 89251693) has the molecular formula C16H13Cl3N2O4S and a molecular weight of 435.72 g/mol. Its IUPAC name is 4-(2-oxo-1,3-diazinan-1-yl)-2-(2,4,5-trichlorophenyl)benzenesulfonic acid.
| Compound Name | 4-(2-oxo-1,3-diazinan-1-yl)-2-(2,4,5-trichlorophenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 89251693 |
| Molecular Formula | C16H13Cl3N2O4S |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | 4-(2-oxo-1,3-diazinan-1-yl)-2-(2,4,5-trichlorophenyl)benzenesulfonic acid |
| SMILES | O=C1NCCCN1c1ccc(S(=O)(=O)O)c(-c2cc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl3N2O4S/c17-12-8-14(19)13(18)7-10(12)11-6-9(2-3-15(11)26(23,24)25)21-5-1-4-20-16(21)22/h2-3,6-8H,1,4-5H2,(H,20,22)(H,23,24,25) |
| InChIKey | LVGDZDKLSRLVKW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|