About (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate
(2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate (PubChem CID 89251732) has the molecular formula C15H12N4O8S
and a molecular weight of 408.35 g/mol. Its IUPAC name is (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
| PubChem CID | 89251732 |
| Molecular Formula | C15H12N4O8S |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate |
| SMILES | O=C1NCCN1c1ccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N4O8S/c20-15-16-7-8-17(15)10-1-4-12(5-2-10)28(25,26)27-14-6-3-11(18(21)22)9-13(14)19(23)24/h1-6,9H,7-8H2,(H,16,20) |
| InChIKey | ZLXDSFUHADYVCY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate?
The IUPAC name of (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate (CID 89251732) is (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate.
What is the SMILES notation for (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate?
The canonical SMILES for (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate is O=C1NCCN1c1ccc(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1.
What is the InChIKey of (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate?
The InChIKey is ZLXDSFUHADYVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O8S/c20-15-16-7-8-17(15)10-1-4-12(5-2-10)28(25,26)27-14-6-3-11(18(21)22)9-13(14)19(23)24/h1-6,9H,7-8H2,(H,16,20).
What are the key properties of (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate?
(2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate has a molecular weight of 408.35 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl) 4-(2-oxoimidazolidin-1-yl)benzenesulfonate is sourced from PubChem (CID 89251732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).