C28H26F3N7O6 — CID 89251799
(2,2,2-trifluoroacetyl) 4-[[1-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-3-yl]carbamoyl]benzoate (PubChem CID 89251799) has the molecular formula C28H26F3N7O6 and a molecular weight of 613.55 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[[1-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-3-yl]carbamoyl]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[[1-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 89251799 |
| Molecular Formula | C28H26F3N7O6 |
| Molecular Weight | 613.55 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[[1-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]piperidin-3-yl]carbamoyl]benzoate |
| SMILES | COc1ccc(Nc2cc(N3CCCC(NC(=O)c4ccc(C(=O)OC(=O)C(F)(F)F)cc4)C3)cn3ncnc23)nc1OC |
| InChI | InChI=1S/C28H26F3N7O6/c1-42-21-9-10-22(36-25(21)43-2)35-20-12-19(14-38-23(20)32-15-33-38)37-11-3-4-18(13-37)34-24(39)16-5-7-17(8-6-16)26(40)44-27(41)28(29,30)31/h5-10,12,14-15,18H,3-4,11,13H2,1-2H3,(H,34,39)(H,35,36) |
| InChIKey | WAXVPUUARCBGAR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|