C20H22F6O3S — CID 89251880
[4-(1-adamantyl)phenyl] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate (PubChem CID 89251880) has the molecular formula C20H22F6O3S and a molecular weight of 456.45 g/mol. Its IUPAC name is [4-(1-adamantyl)phenyl] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate.
| Compound Name | [4-(1-adamantyl)phenyl] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 89251880 |
| Molecular Formula | C20H22F6O3S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [4-(1-adamantyl)phenyl] 1,1,2,2,3,3-hexafluorobutane-1-sulfonate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H22F6O3S/c1-17(21,22)19(23,24)20(25,26)30(27,28)29-16-4-2-15(3-5-16)18-9-12-6-13(10-18)8-14(7-12)11-18/h2-5,12-14H,6-11H2,1H3 |
| InChIKey | DCNRZVDGALZIQK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|