C5BF5N3Rb — CID 89251934
rubidium(1+);tricyano(1,1,2,2,2-pentafluoroethyl)boranuide (PubChem CID 89251934) has the molecular formula C5BF5N3Rb and a molecular weight of 293.35 g/mol. Its IUPAC name is rubidium(1+);tricyano(1,1,2,2,2-pentafluoroethyl)boranuide.
| Compound Name | rubidium(1+);tricyano(1,1,2,2,2-pentafluoroethyl)boranuide |
|---|---|
| PubChem CID | 89251934 |
| Molecular Formula | C5BF5N3Rb |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 292.92 |
| IUPAC Name | rubidium(1+);tricyano(1,1,2,2,2-pentafluoroethyl)boranuide |
| SMILES | N#C[B-](C#N)(C#N)C(F)(F)C(F)(F)F.[Rb+] |
| InChI | InChI=1S/C5BF5N3.Rb/c7-4(8,5(9,10)11)6(1-12,2-13)3-14;/q-1;+1 |
| InChIKey | ISIKKKDGWOLUPF-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|