About 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon
1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon (PubChem CID 89252039) has the molecular formula C6H7FN2Xe
and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon.
Molecular Properties
| Compound Name | 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon |
| PubChem CID | 89252039 |
| Molecular Formula | C6H7FN2Xe |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon |
| SMILES | C/N=C/C1(F)C=CC=N1.[Xe] |
| InChI | InChI=1S/C6H7FN2.Xe/c1-8-5-6(7)3-2-4-9-6;/h2-5H,1H3;/b8-5+; |
| InChIKey | BDNWSKYVYHFPND-HAAWTFQLSA-N |
| XLogP | 0.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon?
The IUPAC name of 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon (CID 89252039) is 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon.
What is the SMILES notation for 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon?
The canonical SMILES for 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon is C/N=C/C1(F)C=CC=N1.[Xe].
What is the InChIKey of 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon?
The InChIKey is BDNWSKYVYHFPND-HAAWTFQLSA-N. The full InChI is InChI=1S/C6H7FN2.Xe/c1-8-5-6(7)3-2-4-9-6;/h2-5H,1H3;/b8-5+;.
What are the key properties of 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon?
1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon has a molecular weight of 257.42 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoropyrrol-2-yl)-N-methylmethanimine;xenon is sourced from PubChem (CID 89252039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).