About 4-methyl-2,3-dimethylideneoxane
4-methyl-2,3-dimethylideneoxane (PubChem CID 89252301) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 4-methyl-2,3-dimethylideneoxane.
Molecular Properties
| Compound Name | 4-methyl-2,3-dimethylideneoxane |
| PubChem CID | 89252301 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 4-methyl-2,3-dimethylideneoxane |
| SMILES | C=C1OCCC(C)C1=C |
| InChI | InChI=1S/C8H12O/c1-6-4-5-9-8(3)7(6)2/h6H,2-5H2,1H3 |
| InChIKey | QEBSUXQWEFBHCI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2,3-dimethylideneoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dimethylideneoxane?
The IUPAC name of 4-methyl-2,3-dimethylideneoxane (CID 89252301) is 4-methyl-2,3-dimethylideneoxane.
What is the SMILES notation for 4-methyl-2,3-dimethylideneoxane?
The canonical SMILES for 4-methyl-2,3-dimethylideneoxane is C=C1OCCC(C)C1=C.
What is the InChIKey of 4-methyl-2,3-dimethylideneoxane?
The InChIKey is QEBSUXQWEFBHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-6-4-5-9-8(3)7(6)2/h6H,2-5H2,1H3.
What are the key properties of 4-methyl-2,3-dimethylideneoxane?
4-methyl-2,3-dimethylideneoxane has a molecular weight of 124.18 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dimethylideneoxane is sourced from PubChem (CID 89252301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).