C6H10N2 — CID 89252594
4-ethyl-2-methylidene-1,3-dihydroimidazole (PubChem CID 89252594) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 4-ethyl-2-methylidene-1,3-dihydroimidazole.
| Compound Name | 4-ethyl-2-methylidene-1,3-dihydroimidazole |
|---|---|
| PubChem CID | 89252594 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 4-ethyl-2-methylidene-1,3-dihydroimidazole |
| SMILES | C=C1NC=C(CC)N1 |
| InChI | InChI=1S/C6H10N2/c1-3-6-4-7-5(2)8-6/h4,7-8H,2-3H2,1H3 |
| InChIKey | BSUSPHMUDAWOHR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |