About 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene
4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene (PubChem CID 89253732) has the molecular formula C22H34O
and a molecular weight of 314.51 g/mol. Its IUPAC name is 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene.
Molecular Properties
| Compound Name | 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene |
| PubChem CID | 89253732 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene |
| SMILES | C=CCC(CC=C)(CC=C)COCC(CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C22H34O/c1-7-13-21(14-8-2,15-9-3)19-23-20-22(16-10-4,17-11-5)18-12-6/h7-12H,1-6,13-20H2 |
| InChIKey | GTAFTLPQLUJUGE-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene?
The IUPAC name of 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene (CID 89253732) is 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene.
What is the SMILES notation for 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene?
The canonical SMILES for 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene is C=CCC(CC=C)(CC=C)COCC(CC=C)(CC=C)CC=C.
What is the InChIKey of 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene?
The InChIKey is GTAFTLPQLUJUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34O/c1-7-13-21(14-8-2,15-9-3)19-23-20-22(16-10-4,17-11-5)18-12-6/h7-12H,1-6,13-20H2.
What are the key properties of 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene?
4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene has a molecular weight of 314.51 g/mol, XLogP of 6.43, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-bis(prop-2-enyl)pent-4-enoxymethyl]-4-prop-2-enylhepta-1,6-diene is sourced from PubChem (CID 89253732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).