C21H23N3S — CID 89253762
methyl (3S,3aS)-8-methyl-3-(4-methylphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate (PubChem CID 89253762) has the molecular formula C21H23N3S and a molecular weight of 349.50 g/mol. Its IUPAC name is methyl (3S,3aS)-8-methyl-3-(4-methylphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate.
| Compound Name | methyl (3S,3aS)-8-methyl-3-(4-methylphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
|---|---|
| PubChem CID | 89253762 |
| Molecular Formula | C21H23N3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | methyl (3S,3aS)-8-methyl-3-(4-methylphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
| SMILES | [H]/N=C(\SC)N1N=C2c3cc(C)ccc3CC[C@H]2[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23N3S/c1-13-4-8-16(9-5-13)20-17-11-10-15-7-6-14(2)12-18(15)19(17)23-24(20)21(22)25-3/h4-9,12,17,20,22H,10-11H2,1-3H3/b22-21-/t17-,20-/m1/s1 |
| InChIKey | XWSBZQQOQRDTJJ-INLJBTSHSA-N |
| XLogP | 4.92 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|