C16H15N5 — CID 892542
2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 892542) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 892542 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-N-benzyl-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H15N5/c17-15-19-14(13-9-5-2-6-10-13)20-16(21-15)18-11-12-7-3-1-4-8-12/h1-10H,11H2,(H3,17,18,19,20,21) |
| InChIKey | LDHZXIVBHWRNGD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |