C31H24N10O2 — CID 89254790
3,5-diamino-2,4-bis(phenyldiazenyl)-6-[(4-phenyldiazenylphenyl)diazenyl]benzoic acid (PubChem CID 89254790) has the molecular formula C31H24N10O2 and a molecular weight of 568.60 g/mol. Its IUPAC name is 3,5-diamino-2,4-bis(phenyldiazenyl)-6-[(4-phenyldiazenylphenyl)diazenyl]benzoic acid.
| Compound Name | 3,5-diamino-2,4-bis(phenyldiazenyl)-6-[(4-phenyldiazenylphenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 89254790 |
| Molecular Formula | C31H24N10O2 |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 3,5-diamino-2,4-bis(phenyldiazenyl)-6-[(4-phenyldiazenylphenyl)diazenyl]benzoic acid |
| SMILES | Nc1c(/N=N/c2ccccc2)c(N)c(/N=N/c2ccc(/N=N/c3ccccc3)cc2)c(C(=O)O)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C31H24N10O2/c32-26-28(39-36-21-12-6-2-7-13-21)25(31(42)43)29(27(33)30(26)41-37-22-14-8-3-9-15-22)40-38-24-18-16-23(17-19-24)35-34-20-10-4-1-5-11-20/h1-19H,32-33H2,(H,42,43)/b35-34+,39-36+,40-38+,41-37+ |
| InChIKey | GWVKCBDPVFRYNA-RPZLFSGGSA-N |
| XLogP | 10.21 |
| TPSA | 188.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|