C14H22N2 — CID 89254812
(1E,3E,5E,7E)-N,4,5,6-tetramethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine (PubChem CID 89254812) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (1E,3E,5E,7E)-N,4,5,6-tetramethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine.
| Compound Name | (1E,3E,5E,7E)-N,4,5,6-tetramethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 89254812 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (1E,3E,5E,7E)-N,4,5,6-tetramethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine |
| SMILES | C/N=C/C=C/C(C)=C(C)/C(C)=C/C=C/NC |
| InChI | InChI=1S/C14H22N2/c1-12(8-6-10-15-4)14(3)13(2)9-7-11-16-5/h6-11,15H,1-5H3/b9-7+,10-6+,12-8+,14-13+,16-11+ |
| InChIKey | YUWWWUGMKVMMHE-HYPBKQAISA-N |
| XLogP | 3.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|