About (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene
(E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene (PubChem CID 89254940) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene.
Molecular Properties
| Compound Name | (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene |
| PubChem CID | 89254940 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene |
| SMILES | CC(C)/C=C/CCC(C)(C)COC(C)C |
| InChI | InChI=1S/C14H28O/c1-12(2)9-7-8-10-14(5,6)11-15-13(3)4/h7,9,12-13H,8,10-11H2,1-6H3/b9-7+ |
| InChIKey | RIPUNRNHOOIZGW-VQHVLOKHSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene?
The IUPAC name of (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene (CID 89254940) is (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene.
What is the SMILES notation for (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene?
The canonical SMILES for (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene is CC(C)/C=C/CCC(C)(C)COC(C)C.
What is the InChIKey of (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene?
The InChIKey is RIPUNRNHOOIZGW-VQHVLOKHSA-N. The full InChI is InChI=1S/C14H28O/c1-12(2)9-7-8-10-14(5,6)11-15-13(3)4/h7,9,12-13H,8,10-11H2,1-6H3/b9-7+.
What are the key properties of (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene?
(E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene has a molecular weight of 212.38 g/mol, XLogP of 4.43, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,7,7-trimethyl-8-propan-2-yloxyoct-3-ene is sourced from PubChem (CID 89254940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).