About ethyl (Z)-3,5-diamino-5-oxopent-3-enoate
ethyl (Z)-3,5-diamino-5-oxopent-3-enoate (PubChem CID 89255720) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is ethyl (Z)-3,5-diamino-5-oxopent-3-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-3,5-diamino-5-oxopent-3-enoate |
| PubChem CID | 89255720 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | ethyl (Z)-3,5-diamino-5-oxopent-3-enoate |
| SMILES | CCOC(=O)C/C(N)=C/C(N)=O |
| InChI | InChI=1S/C7H12N2O3/c1-2-12-7(11)4-5(8)3-6(9)10/h3H,2,4,8H2,1H3,(H2,9,10)/b5-3- |
| InChIKey | OSEOZOQJFZHRJD-HYXAFXHYSA-N |
| XLogP | -0.73 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3,5-diamino-5-oxopent-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3,5-diamino-5-oxopent-3-enoate?
The IUPAC name of ethyl (Z)-3,5-diamino-5-oxopent-3-enoate (CID 89255720) is ethyl (Z)-3,5-diamino-5-oxopent-3-enoate.
What is the SMILES notation for ethyl (Z)-3,5-diamino-5-oxopent-3-enoate?
The canonical SMILES for ethyl (Z)-3,5-diamino-5-oxopent-3-enoate is CCOC(=O)C/C(N)=C/C(N)=O.
What is the InChIKey of ethyl (Z)-3,5-diamino-5-oxopent-3-enoate?
The InChIKey is OSEOZOQJFZHRJD-HYXAFXHYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-2-12-7(11)4-5(8)3-6(9)10/h3H,2,4,8H2,1H3,(H2,9,10)/b5-3-.
What are the key properties of ethyl (Z)-3,5-diamino-5-oxopent-3-enoate?
ethyl (Z)-3,5-diamino-5-oxopent-3-enoate has a molecular weight of 172.18 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3,5-diamino-5-oxopent-3-enoate is sourced from PubChem (CID 89255720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).