About 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol
4-amino-1,2,3,4-tetrahydropyrimidin-2-ol (PubChem CID 89255787) has the molecular formula C4H9N3O
and a molecular weight of 115.14 g/mol. Its IUPAC name is 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol.
Molecular Properties
| Compound Name | 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol |
| PubChem CID | 89255787 |
| Molecular Formula | C4H9N3O |
| Molecular Weight | 115.14 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol |
| SMILES | NC1C=CNC(O)N1 |
| InChI | InChI=1S/C4H9N3O/c5-3-1-2-6-4(8)7-3/h1-4,6-8H,5H2 |
| InChIKey | ZUZMAFWLRQDZNH-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.14 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol?
The IUPAC name of 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol (CID 89255787) is 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol.
What is the SMILES notation for 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol?
The canonical SMILES for 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol is NC1C=CNC(O)N1.
What is the InChIKey of 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol?
The InChIKey is ZUZMAFWLRQDZNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3O/c5-3-1-2-6-4(8)7-3/h1-4,6-8H,5H2.
What are the key properties of 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol?
4-amino-1,2,3,4-tetrahydropyrimidin-2-ol has a molecular weight of 115.14 g/mol, XLogP of -1.75, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2,3,4-tetrahydropyrimidin-2-ol is sourced from PubChem (CID 89255787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).