C27H23N3O8P+ — CID 89256068
(2,5-dioxopyrrolidin-1-yl) 3-[[4-[5-(4-methoxy-3-phosphanylperoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzoate (PubChem CID 89256068) has the molecular formula C27H23N3O8P+ and a molecular weight of 548.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[[4-[5-(4-methoxy-3-phosphanylperoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[[4-[5-(4-methoxy-3-phosphanylperoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 89256068 |
| Molecular Formula | C27H23N3O8P+ |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[[4-[5-(4-methoxy-3-phosphanylperoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzoate |
| SMILES | COc1ccc(-c2cnc(-c3cc[n+](Cc4cccc(C(=O)ON5C(=O)CCC5=O)c4)cc3)o2)cc1OOP |
| InChI | InChI=1S/C27H23N3O8P/c1-34-21-6-5-19(14-22(21)37-38-39)23-15-28-26(35-23)18-9-11-29(12-10-18)16-17-3-2-4-20(13-17)27(33)36-30-24(31)7-8-25(30)32/h2-6,9-15H,7-8,16,39H2,1H3/q+1 |
| InChIKey | SAJHFSVADHAESY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 121.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|