C29H24ClNO5 — CID 89256164
(5-chloro-8-oxo-14-phenyl-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-yl) formate (PubChem CID 89256164) has the molecular formula C29H24ClNO5 and a molecular weight of 501.97 g/mol. Its IUPAC name is (5-chloro-8-oxo-14-phenyl-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-yl) formate.
| Compound Name | (5-chloro-8-oxo-14-phenyl-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-yl) formate |
|---|---|
| PubChem CID | 89256164 |
| Molecular Formula | C29H24ClNO5 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (5-chloro-8-oxo-14-phenyl-3,7-dioxa-21-azahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-1(25),2(15),4(13),5,11,16-hexaen-14-yl) formate |
| SMILES | O=COC1(c2ccccc2)c2cc3c(c(Cl)c2Oc2c1cc1c4c2CCCN4CCC1)OC(=O)CC3 |
| InChI | InChI=1S/C29H24ClNO5/c30-24-26-18(10-11-23(33)35-26)15-22-28(24)36-27-20-9-5-13-31-12-4-6-17(25(20)31)14-21(27)29(22,34-16-32)19-7-2-1-3-8-19/h1-3,7-8,14-16H,4-6,9-13H2 |
| InChIKey | XNQYPHIQVZKSPR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|