C29H26ClNO6 — CID 89256165
3-(5-chloro-10-formyloxy-6-hydroxy-10-phenyl-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-7-yl)propanoic acid (PubChem CID 89256165) has the molecular formula C29H26ClNO6 and a molecular weight of 519.98 g/mol. Its IUPAC name is 3-(5-chloro-10-formyloxy-6-hydroxy-10-phenyl-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-7-yl)propanoic acid.
| Compound Name | 3-(5-chloro-10-formyloxy-6-hydroxy-10-phenyl-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-7-yl)propanoic acid |
|---|---|
| PubChem CID | 89256165 |
| Molecular Formula | C29H26ClNO6 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 3-(5-chloro-10-formyloxy-6-hydroxy-10-phenyl-3-oxa-17-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(21),2(11),4(9),5,7,12-hexaen-7-yl)propanoic acid |
| SMILES | O=COC1(c2ccccc2)c2cc(CCC(=O)O)c(O)c(Cl)c2Oc2c1cc1c3c2CCCN3CCC1 |
| InChI | InChI=1S/C29H26ClNO6/c30-24-26(35)18(10-11-23(33)34)15-22-28(24)37-27-20-9-5-13-31-12-4-6-17(25(20)31)14-21(27)29(22,36-16-32)19-7-2-1-3-8-19/h1-3,7-8,14-16,35H,4-6,9-13H2,(H,33,34) |
| InChIKey | VPCUUOCEWMMZLX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|