About 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol
1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol (PubChem CID 89256469) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol |
| PubChem CID | 89256469 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol |
| SMILES | C=CC(C/C=C\C)NC(O)CC |
| InChI | InChI=1S/C10H19NO/c1-4-7-8-9(5-2)11-10(12)6-3/h4-5,7,9-12H,2,6,8H2,1,3H3/b7-4- |
| InChIKey | LIQJJWNWKPNOGA-DAXSKMNVSA-N |
| XLogP | 1.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol?
The IUPAC name of 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol (CID 89256469) is 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol.
What is the SMILES notation for 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol?
The canonical SMILES for 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol is C=CC(C/C=C\C)NC(O)CC.
What is the InChIKey of 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol?
The InChIKey is LIQJJWNWKPNOGA-DAXSKMNVSA-N. The full InChI is InChI=1S/C10H19NO/c1-4-7-8-9(5-2)11-10(12)6-3/h4-5,7,9-12H,2,6,8H2,1,3H3/b7-4-.
What are the key properties of 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol?
1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol has a molecular weight of 169.27 g/mol, XLogP of 1.83, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(5Z)-hepta-1,5-dien-3-yl]amino]propan-1-ol is sourced from PubChem (CID 89256469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).