About (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol
(3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol (PubChem CID 89256473) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol.
Molecular Properties
| Compound Name | (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol |
| PubChem CID | 89256473 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol |
| SMILES | CC/C(=C\C=C/CC(O)NC(C)C)NC |
| InChI | InChI=1S/C12H24N2O/c1-5-11(13-4)8-6-7-9-12(15)14-10(2)3/h6-8,10,12-15H,5,9H2,1-4H3/b7-6-,11-8+ |
| InChIKey | RMIBTCBLHWDJOA-BQGCWICQSA-N |
| XLogP | 1.76 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol?
The IUPAC name of (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol (CID 89256473) is (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol.
What is the SMILES notation for (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol?
The canonical SMILES for (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol is CC/C(=C\C=C/CC(O)NC(C)C)NC.
What is the InChIKey of (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol?
The InChIKey is RMIBTCBLHWDJOA-BQGCWICQSA-N. The full InChI is InChI=1S/C12H24N2O/c1-5-11(13-4)8-6-7-9-12(15)14-10(2)3/h6-8,10,12-15H,5,9H2,1-4H3/b7-6-,11-8+.
What are the key properties of (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol?
(3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol has a molecular weight of 212.34 g/mol, XLogP of 1.76, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-6-(methylamino)-1-(propan-2-ylamino)octa-3,5-dien-1-ol is sourced from PubChem (CID 89256473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).