C11H17BrN2O — CID 89256490
5-amino-N-[(3E,5E)-6-bromohexa-1,3,5-trien-3-yl]pentanamide (PubChem CID 89256490) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 5-amino-N-[(3E,5E)-6-bromohexa-1,3,5-trien-3-yl]pentanamide.
| Compound Name | 5-amino-N-[(3E,5E)-6-bromohexa-1,3,5-trien-3-yl]pentanamide |
|---|---|
| PubChem CID | 89256490 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-amino-N-[(3E,5E)-6-bromohexa-1,3,5-trien-3-yl]pentanamide |
| SMILES | C=C/C(=C\C=C\Br)NC(=O)CCCCN |
| InChI | InChI=1S/C11H17BrN2O/c1-2-10(6-5-8-12)14-11(15)7-3-4-9-13/h2,5-6,8H,1,3-4,7,9,13H2,(H,14,15)/b8-5+,10-6+ |
| InChIKey | YOMKQDOQBKUWGC-YLDLMLGBSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|