About N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide
N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide (PubChem CID 89256491) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide.
Molecular Properties
| Compound Name | N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide |
| PubChem CID | 89256491 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide |
| SMILES | C=C/C(=C\CCCN)NC(=O)CCCC |
| InChI | InChI=1S/C12H22N2O/c1-3-5-9-12(15)14-11(4-2)8-6-7-10-13/h4,8H,2-3,5-7,9-10,13H2,1H3,(H,14,15)/b11-8+ |
| InChIKey | MVIDOCSNGKBCNW-DHZHZOJOSA-N |
| XLogP | 2.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide?
The IUPAC name of N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide (CID 89256491) is N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide.
What is the SMILES notation for N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide?
The canonical SMILES for N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide is C=C/C(=C\CCCN)NC(=O)CCCC.
What is the InChIKey of N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide?
The InChIKey is MVIDOCSNGKBCNW-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H22N2O/c1-3-5-9-12(15)14-11(4-2)8-6-7-10-13/h4,8H,2-3,5-7,9-10,13H2,1H3,(H,14,15)/b11-8+.
What are the key properties of N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide?
N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide has a molecular weight of 210.32 g/mol, XLogP of 2.10, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-7-aminohepta-1,3-dien-3-yl]pentanamide is sourced from PubChem (CID 89256491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).