C12H19NS — CID 89256497
(5Z,8Z)-8-ethenylsulfanyldeca-1,5,8-trien-4-amine (PubChem CID 89256497) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is (5Z,8Z)-8-ethenylsulfanyldeca-1,5,8-trien-4-amine.
| Compound Name | (5Z,8Z)-8-ethenylsulfanyldeca-1,5,8-trien-4-amine |
|---|---|
| PubChem CID | 89256497 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (5Z,8Z)-8-ethenylsulfanyldeca-1,5,8-trien-4-amine |
| SMILES | C=CCC(N)/C=C\C/C(=C/C)SC=C |
| InChI | InChI=1S/C12H19NS/c1-4-8-11(13)9-7-10-12(5-2)14-6-3/h4-7,9,11H,1,3,8,10,13H2,2H3/b9-7-,12-5- |
| InChIKey | IMIYAYKSFUTMCG-NTNHMUGDSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|