C12H23NO2S — CID 89256506
2-methyl-N-[(4R,5Z)-octa-1,5-dien-4-yl]propane-2-sulfonamide (PubChem CID 89256506) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is 2-methyl-N-[(4R,5Z)-octa-1,5-dien-4-yl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[(4R,5Z)-octa-1,5-dien-4-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 89256506 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-methyl-N-[(4R,5Z)-octa-1,5-dien-4-yl]propane-2-sulfonamide |
| SMILES | C=CC[C@H](/C=C\CC)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO2S/c1-6-8-10-11(9-7-2)13-16(14,15)12(3,4)5/h7-8,10-11,13H,2,6,9H2,1,3-5H3/b10-8-/t11-/m1/s1 |
| InChIKey | BVBSBYGRMBPFKI-HIJJYWJESA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|