C13H19FN2O2 — CID 89256522
N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-yl]formamide (PubChem CID 89256522) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-yl]formamide.
| Compound Name | N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-yl]formamide |
|---|---|
| PubChem CID | 89256522 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[4-(3-fluoro-2,6-dimethylmorpholin-4-yl)cyclohexa-2,4-dien-1-yl]formamide |
| SMILES | CC1CN(C2=CCC(NC=O)C=C2)C(F)C(C)O1 |
| InChI | InChI=1S/C13H19FN2O2/c1-9-7-16(13(14)10(2)18-9)12-5-3-11(4-6-12)15-8-17/h3,5-6,8-11,13H,4,7H2,1-2H3,(H,15,17) |
| InChIKey | MRCZFLIIEPVHNC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|