C31H22O4 — CID 89256741
3-[[(1E,3E,5E)-6-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)hexa-1,3,5-trienoxy]methyl]naphthalene-2-carbaldehyde (PubChem CID 89256741) has the molecular formula C31H22O4 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[[(1E,3E,5E)-6-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)hexa-1,3,5-trienoxy]methyl]naphthalene-2-carbaldehyde.
| Compound Name | 3-[[(1E,3E,5E)-6-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)hexa-1,3,5-trienoxy]methyl]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 89256741 |
| Molecular Formula | C31H22O4 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 3-[[(1E,3E,5E)-6-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)hexa-1,3,5-trienoxy]methyl]naphthalene-2-carbaldehyde |
| SMILES | O=Cc1cc2ccccc2cc1CO/C=C/C=C/C=C/C1=C(O)c2cc3ccccc3cc2C1=O |
| InChI | InChI=1S/C31H22O4/c32-19-25-15-21-9-4-5-10-22(21)16-26(25)20-35-14-8-2-1-3-13-27-30(33)28-17-23-11-6-7-12-24(23)18-29(28)31(27)34/h1-19,33H,20H2/b2-1+,13-3+,14-8+ |
| InChIKey | ARRQURCQFHQOEV-OXQOUNAKSA-N |
| XLogP | 7.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|