C18H24N+ — CID 89257004
1-(3-methylbutyl)-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]pyridin-1-ium (PubChem CID 89257004) has the molecular formula C18H24N+ and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-(3-methylbutyl)-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]pyridin-1-ium.
| Compound Name | 1-(3-methylbutyl)-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 89257004 |
| Molecular Formula | C18H24N+ |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-(3-methylbutyl)-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]pyridin-1-ium |
| SMILES | C=C=C/C=C(\C=C/C)c1cc[n+](CCC(C)C)cc1 |
| InChI | InChI=1S/C18H24N/c1-5-7-9-17(8-6-2)18-11-14-19(15-12-18)13-10-16(3)4/h6-9,11-12,14-16H,1,10,13H2,2-4H3/q+1/b8-6-,17-9+ |
| InChIKey | BDCSWLCDBNHLOK-DZCRTHFOSA-N |
| XLogP | 4.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|