About 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole
2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole (PubChem CID 89257125) has the molecular formula C8H8FN3S
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole |
| PubChem CID | 89257125 |
| Molecular Formula | C8H8FN3S |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole |
| SMILES | Cc1nn(C)c(-c2nccs2)c1F |
| InChI | InChI=1S/C8H8FN3S/c1-5-6(9)7(12(2)11-5)8-10-3-4-13-8/h3-4H,1-2H3 |
| InChIKey | HMCSUVBHQQGHQZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole?
The IUPAC name of 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole (CID 89257125) is 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole.
What is the SMILES notation for 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole?
The canonical SMILES for 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole is Cc1nn(C)c(-c2nccs2)c1F.
What is the InChIKey of 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole?
The InChIKey is HMCSUVBHQQGHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3S/c1-5-6(9)7(12(2)11-5)8-10-3-4-13-8/h3-4H,1-2H3.
What are the key properties of 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole?
2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole has a molecular weight of 197.24 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-1,3-dimethylpyrazol-5-yl)-1,3-thiazole is sourced from PubChem (CID 89257125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).