C13H20N2 — CID 89257142
3-[(1Z,3Z)-penta-1,3-dienyl]-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 89257142) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-[(1Z,3Z)-penta-1,3-dienyl]-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 3-[(1Z,3Z)-penta-1,3-dienyl]-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 89257142 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-[(1Z,3Z)-penta-1,3-dienyl]-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | C/C=C\C=C/C1=CC2(CCNCC2)CN1 |
| InChI | InChI=1S/C13H20N2/c1-2-3-4-5-12-10-13(11-15-12)6-8-14-9-7-13/h2-5,10,14-15H,6-9,11H2,1H3/b3-2-,5-4- |
| InChIKey | YNWICSIDRVQJEK-LDIADDGTSA-N |
| XLogP | 1.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|