About 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene
9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene (PubChem CID 89257143) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene.
Molecular Properties
| Compound Name | 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene |
| PubChem CID | 89257143 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene |
| SMILES | C=C/C=C\C1=C(C)CC2(CCNCC2)CC1 |
| InChI | InChI=1S/C15H23N/c1-3-4-5-14-6-7-15(12-13(14)2)8-10-16-11-9-15/h3-5,16H,1,6-12H2,2H3/b5-4- |
| InChIKey | NZGBTQCKJRDUBQ-PLNGDYQASA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene?
The IUPAC name of 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene (CID 89257143) is 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene.
What is the SMILES notation for 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene?
The canonical SMILES for 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene is C=C/C=C\C1=C(C)CC2(CCNCC2)CC1.
What is the InChIKey of 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene?
The InChIKey is NZGBTQCKJRDUBQ-PLNGDYQASA-N. The full InChI is InChI=1S/C15H23N/c1-3-4-5-14-6-7-15(12-13(14)2)8-10-16-11-9-15/h3-5,16H,1,6-12H2,2H3/b5-4-.
What are the key properties of 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene?
9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene has a molecular weight of 217.36 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1Z)-buta-1,3-dienyl]-10-methyl-3-azaspiro[5.5]undec-9-ene is sourced from PubChem (CID 89257143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).