C7H12F2N2 — CID 89257459
(3aS,6aR)-6,6-difluoro-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrol-3a-amine (PubChem CID 89257459) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is (3aS,6aR)-6,6-difluoro-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrol-3a-amine.
| Compound Name | (3aS,6aR)-6,6-difluoro-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrol-3a-amine |
|---|---|
| PubChem CID | 89257459 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3aS,6aR)-6,6-difluoro-1,2,3,4,5,6a-hexahydrocyclopenta[c]pyrrol-3a-amine |
| SMILES | N[C@@]12CCC(F)(F)[C@@H]1CNC2 |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)2-1-6(10)4-11-3-5(6)7/h5,11H,1-4,10H2/t5-,6-/m1/s1 |
| InChIKey | AWKHCVVPKXOMPS-PHDIDXHHSA-N |
| XLogP | 0.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |