About (3E,5Z)-3-iodohepta-1,3,5-triene
(3E,5Z)-3-iodohepta-1,3,5-triene (PubChem CID 89257521) has the molecular formula C7H9I
and a molecular weight of 220.05 g/mol. Its IUPAC name is (3E,5Z)-3-iodohepta-1,3,5-triene.
Molecular Properties
| Compound Name | (3E,5Z)-3-iodohepta-1,3,5-triene |
| PubChem CID | 89257521 |
| Molecular Formula | C7H9I |
| Molecular Weight | 220.05 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | (3E,5Z)-3-iodohepta-1,3,5-triene |
| SMILES | C=C/C(I)=C\C=C/C |
| InChI | InChI=1S/C7H9I/c1-3-5-6-7(8)4-2/h3-6H,2H2,1H3/b5-3-,7-6+ |
| InChIKey | ORTKSDOSWKZEKW-AIJKMKQJSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5Z)-3-iodohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5Z)-3-iodohepta-1,3,5-triene?
The IUPAC name of (3E,5Z)-3-iodohepta-1,3,5-triene (CID 89257521) is (3E,5Z)-3-iodohepta-1,3,5-triene.
What is the SMILES notation for (3E,5Z)-3-iodohepta-1,3,5-triene?
The canonical SMILES for (3E,5Z)-3-iodohepta-1,3,5-triene is C=C/C(I)=C\C=C/C.
What is the InChIKey of (3E,5Z)-3-iodohepta-1,3,5-triene?
The InChIKey is ORTKSDOSWKZEKW-AIJKMKQJSA-N. The full InChI is InChI=1S/C7H9I/c1-3-5-6-7(8)4-2/h3-6H,2H2,1H3/b5-3-,7-6+.
What are the key properties of (3E,5Z)-3-iodohepta-1,3,5-triene?
(3E,5Z)-3-iodohepta-1,3,5-triene has a molecular weight of 220.05 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5Z)-3-iodohepta-1,3,5-triene is sourced from PubChem (CID 89257521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).