C26H47N7O5 — CID 89257614
3-[2-[[(Z)-2-[[N-(2,3-diiminobutyl)-C-methylcarbonimidoyl]amino]but-1-enyl]-hydroxyamino]butanoylamino]-5-[hexyl(methyl)amino]-4-oxopentanoic acid (PubChem CID 89257614) has the molecular formula C26H47N7O5 and a molecular weight of 537.71 g/mol. Its IUPAC name is 3-[2-[[(Z)-2-[[N-(2,3-diiminobutyl)-C-methylcarbonimidoyl]amino]but-1-enyl]-hydroxyamino]butanoylamino]-5-[hexyl(methyl)amino]-4-oxopentanoic acid.
| Compound Name | 3-[2-[[(Z)-2-[[N-(2,3-diiminobutyl)-C-methylcarbonimidoyl]amino]but-1-enyl]-hydroxyamino]butanoylamino]-5-[hexyl(methyl)amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 89257614 |
| Molecular Formula | C26H47N7O5 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | 3-[2-[[(Z)-2-[[N-(2,3-diiminobutyl)-C-methylcarbonimidoyl]amino]but-1-enyl]-hydroxyamino]butanoylamino]-5-[hexyl(methyl)amino]-4-oxopentanoic acid |
| SMILES | [H]/N=C(C/N=C(\C)N/C(=C\N(O)C(CC)C(=O)NC(CC(=O)O)C(=O)CN(C)CCCCCC)CC)\C(C)=N\[H] |
| InChI | InChI=1S/C26H47N7O5/c1-7-10-11-12-13-32(6)17-24(34)22(14-25(35)36)31-26(37)23(9-3)33(38)16-20(8-2)30-19(5)29-15-21(28)18(4)27/h16,22-23,27-28,38H,7-15,17H2,1-6H3,(H,29,30)(H,31,37)(H,35,36)/b20-16-,27-18+,28-21- |
| InChIKey | WXLZEMOZKKNPHR-HOLXSBOFSA-N |
| XLogP | 2.82 |
| TPSA | 182.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|