C18H15F6N5 — CID 89257681
2-N-(2,2-difluoropropyl)-6-(4-fluorophenyl)-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine (PubChem CID 89257681) has the molecular formula C18H15F6N5 and a molecular weight of 415.34 g/mol. Its IUPAC name is 2-N-(2,2-difluoropropyl)-6-(4-fluorophenyl)-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,2-difluoropropyl)-6-(4-fluorophenyl)-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89257681 |
| Molecular Formula | C18H15F6N5 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-N-(2,2-difluoropropyl)-6-(4-fluorophenyl)-4-N-(2,2,2-trifluoroethyl)pyrido[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CC(F)(F)CNc1nc(NCC(F)(F)F)c2nc(-c3ccc(F)cc3)ccc2n1 |
| InChI | InChI=1S/C18H15F6N5/c1-17(20,21)8-26-16-28-13-7-6-12(10-2-4-11(19)5-3-10)27-14(13)15(29-16)25-9-18(22,23)24/h2-7H,8-9H2,1H3,(H2,25,26,28,29) |
| InChIKey | HRDFSTNHSKOKJS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |