About (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide
(Z)-3-amino-N',4,4-trimethylpent-2-enimidamide (PubChem CID 89257921) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide |
| PubChem CID | 89257921 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide |
| SMILES | C/N=C(N)/C=C(\N)C(C)(C)C |
| InChI | InChI=1S/C8H17N3/c1-8(2,3)6(9)5-7(10)11-4/h5H,9H2,1-4H3,(H2,10,11)/b6-5- |
| InChIKey | HYKGORBBZGPGES-WAYWQWQTSA-N |
| XLogP | 0.86 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide?
The IUPAC name of (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide (CID 89257921) is (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide.
What is the SMILES notation for (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide?
The canonical SMILES for (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide is C/N=C(N)/C=C(\N)C(C)(C)C.
What is the InChIKey of (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide?
The InChIKey is HYKGORBBZGPGES-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H17N3/c1-8(2,3)6(9)5-7(10)11-4/h5H,9H2,1-4H3,(H2,10,11)/b6-5-.
What are the key properties of (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide?
(Z)-3-amino-N',4,4-trimethylpent-2-enimidamide has a molecular weight of 155.24 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N',4,4-trimethylpent-2-enimidamide is sourced from PubChem (CID 89257921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).